C8H20O5Si — CID 158366943
2,2-dimethoxyethoxy(diethoxy)silane (PubChem CID 158366943) has the molecular formula C8H20O5Si and a molecular weight of 224.33 g/mol. Its IUPAC name is 2,2-dimethoxyethoxy(diethoxy)silane.
| Compound Name | 2,2-dimethoxyethoxy(diethoxy)silane |
|---|---|
| PubChem CID | 158366943 |
| Molecular Formula | C8H20O5Si |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2,2-dimethoxyethoxy(diethoxy)silane |
| SMILES | CCO[SiH](OCC)OCC(OC)OC |
| InChI | InChI=1S/C8H20O5Si/c1-5-11-14(12-6-2)13-7-8(9-3)10-4/h8,14H,5-7H2,1-4H3 |
| InChIKey | POLDTCCAORQWKT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|