C7H18O2Si — CID 174743035
1,1-dimethoxypentan-3-ylsilane (PubChem CID 174743035) has the molecular formula C7H18O2Si and a molecular weight of 162.30 g/mol. Its IUPAC name is 1,1-dimethoxypentan-3-ylsilane.
| Compound Name | 1,1-dimethoxypentan-3-ylsilane |
|---|---|
| PubChem CID | 174743035 |
| Molecular Formula | C7H18O2Si |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 1,1-dimethoxypentan-3-ylsilane |
| SMILES | CCC([SiH3])CC(OC)OC |
| InChI | InChI=1S/C7H18O2Si/c1-4-6(10)5-7(8-2)9-3/h6-7H,4-5H2,1-3,10H3 |
| InChIKey | OEFWYBJUGXVYSC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|