C10H15Cl5O4 — CID 102478815
[(2R,3S,4S)-3,4-dichloro-6,6-dimethoxyhexan-2-yl] 2,2,2-trichloroacetate (PubChem CID 102478815) has the molecular formula C10H15Cl5O4 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-dichloro-6,6-dimethoxyhexan-2-yl] 2,2,2-trichloroacetate.
| Compound Name | [(2R,3S,4S)-3,4-dichloro-6,6-dimethoxyhexan-2-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 102478815 |
| Molecular Formula | C10H15Cl5O4 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | [(2R,3S,4S)-3,4-dichloro-6,6-dimethoxyhexan-2-yl] 2,2,2-trichloroacetate |
| SMILES | COC(C[C@H](Cl)[C@@H](Cl)[C@@H](C)OC(=O)C(Cl)(Cl)Cl)OC |
| InChI | InChI=1S/C10H15Cl5O4/c1-5(19-9(16)10(13,14)15)8(12)6(11)4-7(17-2)18-3/h5-8H,4H2,1-3H3/t5-,6+,8+/m1/s1 |
| InChIKey | BXPDSWNJHVWFJO-CHKWXVPMSA-N |
| XLogP | 3.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|