C8H13Cl3O3 — CID 71340882
1-(2-methylpropoxy)ethyl 2,2,2-trichloroacetate (PubChem CID 71340882) has the molecular formula C8H13Cl3O3 and a molecular weight of 263.55 g/mol. Its IUPAC name is 1-(2-methylpropoxy)ethyl 2,2,2-trichloroacetate.
| Compound Name | 1-(2-methylpropoxy)ethyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 71340882 |
| Molecular Formula | C8H13Cl3O3 |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 1-(2-methylpropoxy)ethyl 2,2,2-trichloroacetate |
| SMILES | CC(C)COC(C)OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H13Cl3O3/c1-5(2)4-13-6(3)14-7(12)8(9,10)11/h5-6H,4H2,1-3H3 |
| InChIKey | IOSKKCDKIDKHBG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|