C18H8Cl18O12 — CID 518752
2,3,4,5,6-pentakis[(2,2,2-trichloroacetyl)oxy]hexyl 2,2,2-trichloroacetate (PubChem CID 518752) has the molecular formula C18H8Cl18O12 and a molecular weight of 1054.40 g/mol. Its IUPAC name is 2,3,4,5,6-pentakis[(2,2,2-trichloroacetyl)oxy]hexyl 2,2,2-trichloroacetate.
| Compound Name | 2,3,4,5,6-pentakis[(2,2,2-trichloroacetyl)oxy]hexyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 518752 |
| Molecular Formula | C18H8Cl18O12 |
| Molecular Weight | 1054.40 g/mol |
| Exact Mass | 1045.44 |
| IUPAC Name | 2,3,4,5,6-pentakis[(2,2,2-trichloroacetyl)oxy]hexyl 2,2,2-trichloroacetate |
| SMILES | O=C(OCC(OC(=O)C(Cl)(Cl)Cl)C(OC(=O)C(Cl)(Cl)Cl)C(OC(=O)C(Cl)(Cl)Cl)C(COC(=O)C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H8Cl18O12/c19-13(20,21)7(37)43-1-3(45-9(39)15(25,26)27)5(47-11(41)17(31,32)33)6(48-12(42)18(34,35)36)4(46-10(40)16(28,29)30)2-44-8(38)14(22,23)24/h3-6H,1-2H2 |
| InChIKey | AVWKGFLULWRTFJ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.40 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|