C5H10Cl2O2 — CID 130737301
(1S,3R)-1,3-dichloro-1,3-dimethoxypropane (PubChem CID 130737301) has the molecular formula C5H10Cl2O2 and a molecular weight of 173.04 g/mol. Its IUPAC name is (1S,3R)-1,3-dichloro-1,3-dimethoxypropane.
| Compound Name | (1S,3R)-1,3-dichloro-1,3-dimethoxypropane |
|---|---|
| PubChem CID | 130737301 |
| Molecular Formula | C5H10Cl2O2 |
| Molecular Weight | 173.04 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | (1S,3R)-1,3-dichloro-1,3-dimethoxypropane |
| SMILES | CO[C@H](Cl)C[C@H](Cl)OC |
| InChI | InChI=1S/C5H10Cl2O2/c1-8-4(6)3-5(7)9-2/h4-5H,3H2,1-2H3/t4-,5+ |
| InChIKey | AFJQIFVWBAWDHM-SYDPRGILSA-N |
| XLogP | 1.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.04 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|