C13H21ClO — CID 123214349
1-(2-chloro-2-methoxyethyl)tricyclo[5.1.1.13,5]decane (PubChem CID 123214349) has the molecular formula C13H21ClO and a molecular weight of 228.76 g/mol. Its IUPAC name is 1-(2-chloro-2-methoxyethyl)tricyclo[5.1.1.13,5]decane.
| Compound Name | 1-(2-chloro-2-methoxyethyl)tricyclo[5.1.1.13,5]decane |
|---|---|
| PubChem CID | 123214349 |
| Molecular Formula | C13H21ClO |
| Molecular Weight | 228.76 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-(2-chloro-2-methoxyethyl)tricyclo[5.1.1.13,5]decane |
| SMILES | COC(Cl)CC12CC3CC(C3)CC(C1)C2 |
| InChI | InChI=1S/C13H21ClO/c1-15-12(14)8-13-5-10-2-9(3-10)4-11(6-13)7-13/h9-12H,2-8H2,1H3 |
| InChIKey | GWYBHYGVRHHRRO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|