C12H27NO4 — CID 176937232
2-[6,6-dimethoxyhexyl(2-hydroxyethyl)amino]ethanol (PubChem CID 176937232) has the molecular formula C12H27NO4 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-[6,6-dimethoxyhexyl(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[6,6-dimethoxyhexyl(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 176937232 |
| Molecular Formula | C12H27NO4 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 2-[6,6-dimethoxyhexyl(2-hydroxyethyl)amino]ethanol |
| SMILES | COC(CCCCCN(CCO)CCO)OC |
| InChI | InChI=1S/C12H27NO4/c1-16-12(17-2)6-4-3-5-7-13(8-10-14)9-11-15/h12,14-15H,3-11H2,1-2H3 |
| InChIKey | PXOGUASKWDROKW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|