C14H33NO6S — CID 142552141
2-[4,4-dimethoxybutyl-[3-(trimethoxy-λ4-sulfanyl)propyl]amino]ethanol (PubChem CID 142552141) has the molecular formula C14H33NO6S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-[4,4-dimethoxybutyl-[3-(trimethoxy-λ4-sulfanyl)propyl]amino]ethanol.
| Compound Name | 2-[4,4-dimethoxybutyl-[3-(trimethoxy-λ4-sulfanyl)propyl]amino]ethanol |
|---|---|
| PubChem CID | 142552141 |
| Molecular Formula | C14H33NO6S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-[4,4-dimethoxybutyl-[3-(trimethoxy-λ4-sulfanyl)propyl]amino]ethanol |
| SMILES | COC(CCCN(CCO)CCCS(OC)(OC)OC)OC |
| InChI | InChI=1S/C14H33NO6S/c1-17-14(18-2)8-6-9-15(11-12-16)10-7-13-22(19-3,20-4)21-5/h14,16H,6-13H2,1-5H3 |
| InChIKey | HNBWALFBQZFDIU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|