C14H29NO2 — CID 134580034
(E)-N-(4,4-dimethoxybutyl)-N-propylpent-3-en-1-amine (PubChem CID 134580034) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is (E)-N-(4,4-dimethoxybutyl)-N-propylpent-3-en-1-amine.
| Compound Name | (E)-N-(4,4-dimethoxybutyl)-N-propylpent-3-en-1-amine |
|---|---|
| PubChem CID | 134580034 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | (E)-N-(4,4-dimethoxybutyl)-N-propylpent-3-en-1-amine |
| SMILES | C/C=C/CCN(CCC)CCCC(OC)OC |
| InChI | InChI=1S/C14H29NO2/c1-5-7-8-12-15(11-6-2)13-9-10-14(16-3)17-4/h5,7,14H,6,8-13H2,1-4H3/b7-5+ |
| InChIKey | SFDZNGPNTMGIQB-FNORWQNLSA-N |
| XLogP | 3.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|