C21H28O3 — CID 46185433
(1R,7R,8R)-1-phenylpentadeca-2,4-diyne-1,7,8-triol (PubChem CID 46185433) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1R,7R,8R)-1-phenylpentadeca-2,4-diyne-1,7,8-triol.
| Compound Name | (1R,7R,8R)-1-phenylpentadeca-2,4-diyne-1,7,8-triol |
|---|---|
| PubChem CID | 46185433 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1R,7R,8R)-1-phenylpentadeca-2,4-diyne-1,7,8-triol |
| SMILES | CCCCCCC[C@@H](O)[C@H](O)CC#CC#C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H28O3/c1-2-3-4-5-10-16-20(23)21(24)17-12-7-11-15-19(22)18-13-8-6-9-14-18/h6,8-9,13-14,19-24H,2-5,10,16-17H2,1H3/t19-,20+,21+/m0/s1 |
| InChIKey | AVLDNBQVIXMYBW-PWRODBHTSA-N |
| XLogP | 3.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|