C17H20O3 — CID 75166098
1-phenylundeca-5,7-diyne-2,3,9-triol (PubChem CID 75166098) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-phenylundeca-5,7-diyne-2,3,9-triol.
| Compound Name | 1-phenylundeca-5,7-diyne-2,3,9-triol |
|---|---|
| PubChem CID | 75166098 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-phenylundeca-5,7-diyne-2,3,9-triol |
| SMILES | CCC(O)C#CC#CCC(O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H20O3/c1-2-15(18)11-7-4-8-12-16(19)17(20)13-14-9-5-3-6-10-14/h3,5-6,9-10,15-20H,2,12-13H2,1H3 |
| InChIKey | JBDZRSPBHHBLTN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|