C20H30O5 — CID 102432868
5,5,6,6-tetraethoxy-1-phenylhex-3-yn-2-ol (PubChem CID 102432868) has the molecular formula C20H30O5 and a molecular weight of 350.45 g/mol. Its IUPAC name is 5,5,6,6-tetraethoxy-1-phenylhex-3-yn-2-ol.
| Compound Name | 5,5,6,6-tetraethoxy-1-phenylhex-3-yn-2-ol |
|---|---|
| PubChem CID | 102432868 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 5,5,6,6-tetraethoxy-1-phenylhex-3-yn-2-ol |
| SMILES | CCOC(OCC)C(C#CC(O)Cc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C20H30O5/c1-5-22-19(23-6-2)20(24-7-3,25-8-4)15-14-18(21)16-17-12-10-9-11-13-17/h9-13,18-19,21H,5-8,16H2,1-4H3 |
| InChIKey | WRPCJDLQBPSFCL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|