C21H28O2 — CID 86084391
3,4-dibenzylheptane-2,5-diol (PubChem CID 86084391) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 3,4-dibenzylheptane-2,5-diol.
| Compound Name | 3,4-dibenzylheptane-2,5-diol |
|---|---|
| PubChem CID | 86084391 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 3,4-dibenzylheptane-2,5-diol |
| SMILES | CCC(O)C(Cc1ccccc1)C(Cc1ccccc1)C(C)O |
| InChI | InChI=1S/C21H28O2/c1-3-21(23)20(15-18-12-8-5-9-13-18)19(16(2)22)14-17-10-6-4-7-11-17/h4-13,16,19-23H,3,14-15H2,1-2H3 |
| InChIKey | UKQAXZRMUYOPBG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |