C19H24O2 — CID 86084378
2,3-dibenzylpentane-1,4-diol (PubChem CID 86084378) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,3-dibenzylpentane-1,4-diol.
| Compound Name | 2,3-dibenzylpentane-1,4-diol |
|---|---|
| PubChem CID | 86084378 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2,3-dibenzylpentane-1,4-diol |
| SMILES | CC(O)C(Cc1ccccc1)C(CO)Cc1ccccc1 |
| InChI | InChI=1S/C19H24O2/c1-15(21)19(13-17-10-6-3-7-11-17)18(14-20)12-16-8-4-2-5-9-16/h2-11,15,18-21H,12-14H2,1H3 |
| InChIKey | BLQHTZYHVZJNRP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |