C18H18I2O2 — CID 139042598
(E,2S,3S)-2-benzyl-4,5-diiodo-5-phenylpent-4-ene-1,3-diol (PubChem CID 139042598) has the molecular formula C18H18I2O2 and a molecular weight of 520.15 g/mol. Its IUPAC name is (E,2S,3S)-2-benzyl-4,5-diiodo-5-phenylpent-4-ene-1,3-diol.
| Compound Name | (E,2S,3S)-2-benzyl-4,5-diiodo-5-phenylpent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 139042598 |
| Molecular Formula | C18H18I2O2 |
| Molecular Weight | 520.15 g/mol |
| Exact Mass | 519.94 |
| IUPAC Name | (E,2S,3S)-2-benzyl-4,5-diiodo-5-phenylpent-4-ene-1,3-diol |
| SMILES | OC[C@H](Cc1ccccc1)[C@H](O)/C(I)=C(\I)c1ccccc1 |
| InChI | InChI=1S/C18H18I2O2/c19-16(14-9-5-2-6-10-14)17(20)18(22)15(12-21)11-13-7-3-1-4-8-13/h1-10,15,18,21-22H,11-12H2/b17-16+/t15-,18-/m0/s1 |
| InChIKey | PQJHNTRWESVFIX-OOXVJCJASA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|