C16H16BrFO2 — CID 57112909
(1R,2S)-2-benzyl-1-(4-bromo-2-fluorophenyl)propane-1,3-diol (PubChem CID 57112909) has the molecular formula C16H16BrFO2 and a molecular weight of 339.20 g/mol. Its IUPAC name is (1R,2S)-2-benzyl-1-(4-bromo-2-fluorophenyl)propane-1,3-diol.
| Compound Name | (1R,2S)-2-benzyl-1-(4-bromo-2-fluorophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 57112909 |
| Molecular Formula | C16H16BrFO2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (1R,2S)-2-benzyl-1-(4-bromo-2-fluorophenyl)propane-1,3-diol |
| SMILES | OC[C@H](Cc1ccccc1)[C@@H](O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C16H16BrFO2/c17-13-6-7-14(15(18)9-13)16(20)12(10-19)8-11-4-2-1-3-5-11/h1-7,9,12,16,19-20H,8,10H2/t12-,16+/m0/s1 |
| InChIKey | IELRXYIMFJLQGR-BLLLJJGKSA-N |
| XLogP | 3.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |