C8H8BrFO2 — CID 82713520
1-(4-bromo-2-fluorophenyl)ethane-1,2-diol (PubChem CID 82713520) has the molecular formula C8H8BrFO2 and a molecular weight of 235.05 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)ethane-1,2-diol.
| Compound Name | 1-(4-bromo-2-fluorophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 82713520 |
| Molecular Formula | C8H8BrFO2 |
| Molecular Weight | 235.05 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)ethane-1,2-diol |
| SMILES | OCC(O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C8H8BrFO2/c9-5-1-2-6(7(10)3-5)8(12)4-11/h1-3,8,11-12H,4H2 |
| InChIKey | CUNKZYRHTPFUML-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.05 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |