C9H11BrFNO2 — CID 66204529
2-amino-1-(4-bromo-2-fluorophenyl)propane-1,3-diol (PubChem CID 66204529) has the molecular formula C9H11BrFNO2 and a molecular weight of 264.09 g/mol. Its IUPAC name is 2-amino-1-(4-bromo-2-fluorophenyl)propane-1,3-diol.
| Compound Name | 2-amino-1-(4-bromo-2-fluorophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 66204529 |
| Molecular Formula | C9H11BrFNO2 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2-amino-1-(4-bromo-2-fluorophenyl)propane-1,3-diol |
| SMILES | NC(CO)C(O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C9H11BrFNO2/c10-5-1-2-6(7(11)3-5)9(14)8(12)4-13/h1-3,8-9,13-14H,4,12H2 |
| InChIKey | SLRWEQNJCABDBY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |