C10H14BrFN2O — CID 83933858
2,4-diamino-1-(5-bromo-2-fluorophenyl)butan-1-ol (PubChem CID 83933858) has the molecular formula C10H14BrFN2O and a molecular weight of 277.14 g/mol. Its IUPAC name is 2,4-diamino-1-(5-bromo-2-fluorophenyl)butan-1-ol.
| Compound Name | 2,4-diamino-1-(5-bromo-2-fluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 83933858 |
| Molecular Formula | C10H14BrFN2O |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2,4-diamino-1-(5-bromo-2-fluorophenyl)butan-1-ol |
| SMILES | NCCC(N)C(O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C10H14BrFN2O/c11-6-1-2-8(12)7(5-6)10(15)9(14)3-4-13/h1-2,5,9-10,15H,3-4,13-14H2 |
| InChIKey | CBXFQSORTYNYPG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |