C10H13BrFNO2 — CID 83933857
2-amino-1-(5-bromo-2-fluorophenyl)butane-1,4-diol (PubChem CID 83933857) has the molecular formula C10H13BrFNO2 and a molecular weight of 278.12 g/mol. Its IUPAC name is 2-amino-1-(5-bromo-2-fluorophenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(5-bromo-2-fluorophenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83933857 |
| Molecular Formula | C10H13BrFNO2 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2-amino-1-(5-bromo-2-fluorophenyl)butane-1,4-diol |
| SMILES | NC(CCO)C(O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C10H13BrFNO2/c11-6-1-2-8(12)7(5-6)10(15)9(13)3-4-14/h1-2,5,9-10,14-15H,3-4,13H2 |
| InChIKey | BNHSPUMTIDULKH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |