C30H46O4 — CID 168849733
(6Z,9Z,12Z,15Z,18Z,21Z)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)tetracosa-6,9,12,15,18,21-hexaen-3-ol (PubChem CID 168849733) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (6Z,9Z,12Z,15Z,18Z,21Z)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)tetracosa-6,9,12,15,18,21-hexaen-3-ol.
| Compound Name | (6Z,9Z,12Z,15Z,18Z,21Z)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)tetracosa-6,9,12,15,18,21-hexaen-3-ol |
|---|---|
| PubChem CID | 168849733 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (6Z,9Z,12Z,15Z,18Z,21Z)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)tetracosa-6,9,12,15,18,21-hexaen-3-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(O)CCC12OCC(C)(CO1)CO2 |
| InChI | InChI=1S/C30H46O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(31)23-24-30-32-25-29(2,26-33-30)27-34-30/h4-5,7-8,10-11,13-14,16-17,19-20,28,31H,3,6,9,12,15,18,21-27H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | NVRWLLAIEWXRLB-JDPCYWKWSA-N |
| XLogP | 7.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|