C20H31NO — CID 91705221
4,4-dimethyl-2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]-5H-1,3-oxazole (PubChem CID 91705221) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 91705221 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 4,4-dimethyl-2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]-5H-1,3-oxazole |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC1=NC(C)(C)CO1 |
| InChI | InChI=1S/C20H31NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-21-20(2,3)18-22-19/h5-6,8-9,11-12,14-15H,4,7,10,13,16-18H2,1-3H3/b6-5-,9-8-,12-11-,15-14- |
| InChIKey | PXRRVZOBLKDXBW-AFSLFLIVSA-N |
| XLogP | 5.78 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|