C22H41NO — CID 5370405
2-[(E)-heptadec-8-enyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 5370405) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is 2-[(E)-heptadec-8-enyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(E)-heptadec-8-enyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 5370405 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | 2-[(E)-heptadec-8-enyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1=NC(C)(C)CO1 |
| InChI | InChI=1S/C22H41NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23-22(2,3)20-24-21/h11-12H,4-10,13-20H2,1-3H3/b12-11+ |
| InChIKey | CHAMUCPNQGNBLJ-VAWYXSNFSA-N |
| XLogP | 7.23 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|