C20H38FNO — CID 91705204
2-(15-fluoropentadecyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 91705204) has the molecular formula C20H38FNO and a molecular weight of 327.53 g/mol. Its IUPAC name is 2-(15-fluoropentadecyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(15-fluoropentadecyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 91705204 |
| Molecular Formula | C20H38FNO |
| Molecular Weight | 327.53 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 2-(15-fluoropentadecyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(CCCCCCCCCCCCCCCF)=N1 |
| InChI | InChI=1S/C20H38FNO/c1-20(2)18-23-19(22-20)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-21/h3-18H2,1-2H3 |
| InChIKey | LTUMFFUMRFWUCM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|