C6H12N2O2 — CID 142932736
O-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]hydroxylamine (PubChem CID 142932736) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is O-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]hydroxylamine.
| Compound Name | O-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 142932736 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | O-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]hydroxylamine |
| SMILES | CC1(C)COC(CON)=N1 |
| InChI | InChI=1S/C6H12N2O2/c1-6(2)4-9-5(8-6)3-10-7/h3-4,7H2,1-2H3 |
| InChIKey | TYESBAWUNXBAGT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|