C22H41NO2 — CID 99116631
[(4R)-2-[(E)-heptadec-8-enyl]-4-methyl-5H-1,3-oxazol-4-yl]methanol (PubChem CID 99116631) has the molecular formula C22H41NO2 and a molecular weight of 351.58 g/mol. Its IUPAC name is [(4R)-2-[(E)-heptadec-8-enyl]-4-methyl-5H-1,3-oxazol-4-yl]methanol.
| Compound Name | [(4R)-2-[(E)-heptadec-8-enyl]-4-methyl-5H-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 99116631 |
| Molecular Formula | C22H41NO2 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.31 |
| IUPAC Name | [(4R)-2-[(E)-heptadec-8-enyl]-4-methyl-5H-1,3-oxazol-4-yl]methanol |
| SMILES | CCCCCCCC/C=C/CCCCCCCC1=N[C@](C)(CO)CO1 |
| InChI | InChI=1S/C22H41NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-23-22(2,19-24)20-25-21/h10-11,24H,3-9,12-20H2,1-2H3/b11-10+/t22-/m1/s1 |
| InChIKey | HCIRJRYSFLWMMS-NELJVSICSA-N |
| XLogP | 6.20 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|