C40H73NO4 — CID 139594313
[2-heptadec-8-enyl-4-(hydroxymethyl)-5H-1,3-oxazol-4-yl]methyl (Z)-octadec-9-enoate (PubChem CID 139594313) has the molecular formula C40H73NO4 and a molecular weight of 632.03 g/mol. Its IUPAC name is [2-heptadec-8-enyl-4-(hydroxymethyl)-5H-1,3-oxazol-4-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [2-heptadec-8-enyl-4-(hydroxymethyl)-5H-1,3-oxazol-4-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 139594313 |
| Molecular Formula | C40H73NO4 |
| Molecular Weight | 632.03 g/mol |
| Exact Mass | 631.55 |
| IUPAC Name | [2-heptadec-8-enyl-4-(hydroxymethyl)-5H-1,3-oxazol-4-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC1=NC(CO)(COC(=O)CCCCCCC/C=C\CCCCCCCC)CO1 |
| InChI | InChI=1S/C40H73NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-41-40(35-42,36-44-38)37-45-39(43)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,42H,3-16,21-37H2,1-2H3/b19-17?,20-18- |
| InChIKey | BENOUNWWROPAGZ-FKVHLOHMSA-N |
| XLogP | 11.76 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.03 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|