C61H104N2O7S2 — CID 164846821
1-S,3-S-bis[2-[bis[(4Z,7Z)-2-hydroxytrideca-4,7-dienyl]amino]ethyl] 2-acetylpropanebis(thioate) (PubChem CID 164846821) has the molecular formula C61H104N2O7S2 and a molecular weight of 1041.64 g/mol. Its IUPAC name is 1-S,3-S-bis[2-[bis[(4Z,7Z)-2-hydroxytrideca-4,7-dienyl]amino]ethyl] 2-acetylpropanebis(thioate).
| Compound Name | 1-S,3-S-bis[2-[bis[(4Z,7Z)-2-hydroxytrideca-4,7-dienyl]amino]ethyl] 2-acetylpropanebis(thioate) |
|---|---|
| PubChem CID | 164846821 |
| Molecular Formula | C61H104N2O7S2 |
| Molecular Weight | 1041.64 g/mol |
| Exact Mass | 1040.73 |
| IUPAC Name | 1-S,3-S-bis[2-[bis[(4Z,7Z)-2-hydroxytrideca-4,7-dienyl]amino]ethyl] 2-acetylpropanebis(thioate) |
| SMILES | CCCCC/C=C\C/C=C\CC(O)CN(CCSC(=O)C(C(C)=O)C(=O)SCCN(CC(O)C/C=C\C/C=C\CCCCC)CC(O)C/C=C\C/C=C\CCCCC)CC(O)C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C61H104N2O7S2/c1-6-10-14-18-22-26-30-34-38-42-55(65)50-62(51-56(66)43-39-35-31-27-23-19-15-11-7-2)46-48-71-60(69)59(54(5)64)61(70)72-49-47-63(52-57(67)44-40-36-32-28-24-20-16-12-8-3)53-58(68)45-41-37-33-29-25-21-17-13-9-4/h22-29,34-41,55-59,65-68H,6-21,30-33,42-53H2,1-5H3/b26-22-,27-23-,28-24-,29-25-,38-34-,39-35-,40-36-,41-37- |
| InChIKey | LKGKPBIZOQJXCQ-JKEPZFAWSA-N |
| XLogP | 13.65 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.64 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|