C9H18O2 — CID 102156036
(E,2S,4S)-non-6-ene-2,4-diol (PubChem CID 102156036) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (E,2S,4S)-non-6-ene-2,4-diol.
| Compound Name | (E,2S,4S)-non-6-ene-2,4-diol |
|---|---|
| PubChem CID | 102156036 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (E,2S,4S)-non-6-ene-2,4-diol |
| SMILES | CC/C=C/C[C@H](O)C[C@H](C)O |
| InChI | InChI=1S/C9H18O2/c1-3-4-5-6-9(11)7-8(2)10/h4-5,8-11H,3,6-7H2,1-2H3/b5-4+/t8-,9-/m0/s1 |
| InChIKey | AXDPBTRZPBZPAL-HXQNXIEXSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|