C13H19N3O — CID 62266148
3-[[2-(2-aminophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile (PubChem CID 62266148) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-[[2-(2-aminophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile.
| Compound Name | 3-[[2-(2-aminophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile |
|---|---|
| PubChem CID | 62266148 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-[[2-(2-aminophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile |
| SMILES | CCN(CCC#N)CC(O)c1ccccc1N |
| InChI | InChI=1S/C13H19N3O/c1-2-16(9-5-8-14)10-13(17)11-6-3-4-7-12(11)15/h3-4,6-7,13,17H,2,5,9-10,15H2,1H3 |
| InChIKey | KGIDSFQMHVFHOS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|