C13H17ClN2O — CID 111634689
3-[[2-(2-chlorophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile (PubChem CID 111634689) has the molecular formula C13H17ClN2O and a molecular weight of 252.75 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile.
| Compound Name | 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile |
|---|---|
| PubChem CID | 111634689 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]-ethylamino]propanenitrile |
| SMILES | CCN(CCC#N)CC(O)c1ccccc1Cl |
| InChI | InChI=1S/C13H17ClN2O/c1-2-16(9-5-8-15)10-13(17)11-6-3-4-7-12(11)14/h3-4,6-7,13,17H,2,5,9-10H2,1H3 |
| InChIKey | YVVPEJKVNWIGIL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |