C16H27ClN2O — CID 102997275
1-(2-chlorophenyl)-3-[3-(dimethylamino)propyl-ethylamino]propan-1-ol (PubChem CID 102997275) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-(dimethylamino)propyl-ethylamino]propan-1-ol.
| Compound Name | 1-(2-chlorophenyl)-3-[3-(dimethylamino)propyl-ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 102997275 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-(dimethylamino)propyl-ethylamino]propan-1-ol |
| SMILES | CCN(CCCN(C)C)CCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C16H27ClN2O/c1-4-19(12-7-11-18(2)3)13-10-16(20)14-8-5-6-9-15(14)17/h5-6,8-9,16,20H,4,7,10-13H2,1-3H3 |
| InChIKey | QFODNBCEIWNYPZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |