C13H18ClN3 — CID 55022708
3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propanenitrile (PubChem CID 55022708) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is 3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propanenitrile.
| Compound Name | 3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propanenitrile |
|---|---|
| PubChem CID | 55022708 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propanenitrile |
| SMILES | CCN(CCC#N)C(CN)c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClN3/c1-2-17(9-5-8-15)13(10-16)11-6-3-4-7-12(11)14/h3-4,6-7,13H,2,5,9-10,16H2,1H3 |
| InChIKey | MWMVVYOHCSUADH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |