C13H21ClN2O — CID 113468616
3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propan-1-ol (PubChem CID 113468616) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propan-1-ol.
| Compound Name | 3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 113468616 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3-[[2-amino-1-(2-chlorophenyl)ethyl]-ethylamino]propan-1-ol |
| SMILES | CCN(CCCO)C(CN)c1ccccc1Cl |
| InChI | InChI=1S/C13H21ClN2O/c1-2-16(8-5-9-17)13(10-15)11-6-3-4-7-12(11)14/h3-4,6-7,13,17H,2,5,8-10,15H2,1H3 |
| InChIKey | PXWOFAHCBPBUEN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |