C17H30N2O — CID 82043559
N-butyl-N-ethyl-1-(2-propan-2-yloxyphenyl)ethane-1,2-diamine (PubChem CID 82043559) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is N-butyl-N-ethyl-1-(2-propan-2-yloxyphenyl)ethane-1,2-diamine.
| Compound Name | N-butyl-N-ethyl-1-(2-propan-2-yloxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82043559 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | N-butyl-N-ethyl-1-(2-propan-2-yloxyphenyl)ethane-1,2-diamine |
| SMILES | CCCCN(CC)C(CN)c1ccccc1OC(C)C |
| InChI | InChI=1S/C17H30N2O/c1-5-7-12-19(6-2)16(13-18)15-10-8-9-11-17(15)20-14(3)4/h8-11,14,16H,5-7,12-13,18H2,1-4H3 |
| InChIKey | VKCDDGFCNULGMU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |