C24H25NO3 — CID 171238967
(S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methanamine (PubChem CID 171238967) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methanamine.
| Compound Name | (S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 171238967 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (S)-(3,4-diphenoxyphenyl)-(oxan-4-yl)methanamine |
| SMILES | N[C@H](c1ccc(Oc2ccccc2)c(Oc2ccccc2)c1)C1CCOCC1 |
| InChI | InChI=1S/C24H25NO3/c25-24(18-13-15-26-16-14-18)19-11-12-22(27-20-7-3-1-4-8-20)23(17-19)28-21-9-5-2-6-10-21/h1-12,17-18,24H,13-16,25H2/t24-/m0/s1 |
| InChIKey | HPDHLUGHEWWGBF-DEOSSOPVSA-N |
| XLogP | 5.70 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |