C11H14ClF2NO — CID 171206136
(R)-cyclopropyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride (PubChem CID 171206136) has the molecular formula C11H14ClF2NO and a molecular weight of 249.69 g/mol. Its IUPAC name is (R)-cyclopropyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride.
| Compound Name | (R)-cyclopropyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171206136 |
| Molecular Formula | C11H14ClF2NO |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (R)-cyclopropyl-[3-(difluoromethoxy)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccc(OC(F)F)c1)C1CC1 |
| InChI | InChI=1S/C11H13F2NO.ClH/c12-11(13)15-9-3-1-2-8(6-9)10(14)7-4-5-7;/h1-3,6-7,10-11H,4-5,14H2;1H/t10-;/m1./s1 |
| InChIKey | PSMCCPIZBYOABS-HNCPQSOCSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |