C16H17N3O5 — CID 75446028
3-(2,4-dimethoxyphenyl)-3-(pyridazine-4-carbonylamino)propanoic acid (PubChem CID 75446028) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3-(pyridazine-4-carbonylamino)propanoic acid.
| Compound Name | 3-(2,4-dimethoxyphenyl)-3-(pyridazine-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 75446028 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-3-(pyridazine-4-carbonylamino)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NC(=O)c2ccnnc2)c(OC)c1 |
| InChI | InChI=1S/C16H17N3O5/c1-23-11-3-4-12(14(7-11)24-2)13(8-15(20)21)19-16(22)10-5-6-17-18-9-10/h3-7,9,13H,8H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | NRDWIURJTHAFJJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |