C22H31NO5S — CID 20721232
(2R)-1-amino-2-methyl-4-[5-(5-phenylpentyl)thiophen-2-yl]butan-1-ol;oxalic acid (PubChem CID 20721232) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is (2R)-1-amino-2-methyl-4-[5-(5-phenylpentyl)thiophen-2-yl]butan-1-ol;oxalic acid.
| Compound Name | (2R)-1-amino-2-methyl-4-[5-(5-phenylpentyl)thiophen-2-yl]butan-1-ol;oxalic acid |
|---|---|
| PubChem CID | 20721232 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (2R)-1-amino-2-methyl-4-[5-(5-phenylpentyl)thiophen-2-yl]butan-1-ol;oxalic acid |
| SMILES | C[C@H](CCc1ccc(CCCCCc2ccccc2)s1)C(N)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H29NOS.C2H2O4/c1-16(20(21)22)12-13-19-15-14-18(23-19)11-7-3-6-10-17-8-4-2-5-9-17;3-1(4)2(5)6/h2,4-5,8-9,14-16,20,22H,3,6-7,10-13,21H2,1H3;(H,3,4)(H,5,6)/t16-,20?;/m1./s1 |
| InChIKey | VTXNXLVTURDGFU-SSEZRWRESA-N |
| XLogP | 3.70 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|