C22H29NO5S — CID 90815646
2-[(2R)-1-amino-4-[5-(1-hydroxy-5-phenylpentyl)thiophen-2-yl]-2-methylbutoxy]-2-oxoacetic acid (PubChem CID 90815646) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is 2-[(2R)-1-amino-4-[5-(1-hydroxy-5-phenylpentyl)thiophen-2-yl]-2-methylbutoxy]-2-oxoacetic acid.
| Compound Name | 2-[(2R)-1-amino-4-[5-(1-hydroxy-5-phenylpentyl)thiophen-2-yl]-2-methylbutoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 90815646 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[(2R)-1-amino-4-[5-(1-hydroxy-5-phenylpentyl)thiophen-2-yl]-2-methylbutoxy]-2-oxoacetic acid |
| SMILES | C[C@H](CCc1ccc(C(O)CCCCc2ccccc2)s1)C(N)OC(=O)C(=O)O |
| InChI | InChI=1S/C22H29NO5S/c1-15(20(23)28-22(27)21(25)26)11-12-17-13-14-19(29-17)18(24)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,13-15,18,20,24H,5-6,9-12,23H2,1H3,(H,25,26)/t15-,18?,20?/m1/s1 |
| InChIKey | ZEXOXZORNUPZQR-MYWSLZCHSA-N |
| XLogP | 3.68 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|