C21H25NO5S — CID 20721223
(2R)-1-amino-2-methyl-4-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]butan-1-ol;oxalic acid (PubChem CID 20721223) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is (2R)-1-amino-2-methyl-4-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]butan-1-ol;oxalic acid.
| Compound Name | (2R)-1-amino-2-methyl-4-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]butan-1-ol;oxalic acid |
|---|---|
| PubChem CID | 20721223 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (2R)-1-amino-2-methyl-4-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]butan-1-ol;oxalic acid |
| SMILES | C[C@H](CCc1ccc(C#CCCc2ccccc2)s1)C(N)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23NOS.C2H2O4/c1-15(19(20)21)11-12-18-14-13-17(22-18)10-6-5-9-16-7-3-2-4-8-16;3-1(4)2(5)6/h2-4,7-8,13-15,19,21H,5,9,11-12,20H2,1H3;(H,3,4)(H,5,6)/t15-,19?;/m1./s1 |
| InChIKey | JTOHLDGLKDDWKO-FMBFNYOVSA-N |
| XLogP | 2.73 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|