C20H25NO2S — CID 22279654
2-amino-2-methyl-4-[5-(5-phenoxypent-1-ynyl)thiophen-2-yl]butan-1-ol (PubChem CID 22279654) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-(5-phenoxypent-1-ynyl)thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-(5-phenoxypent-1-ynyl)thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 22279654 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-amino-2-methyl-4-[5-(5-phenoxypent-1-ynyl)thiophen-2-yl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(C#CCCCOc2ccccc2)s1 |
| InChI | InChI=1S/C20H25NO2S/c1-20(21,16-22)14-13-19-12-11-18(24-19)10-6-3-7-15-23-17-8-4-2-5-9-17/h2,4-5,8-9,11-12,22H,3,7,13-16,21H2,1H3 |
| InChIKey | FURRPIDEFZGOMY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|