C24H28FNO5S — CID 69339258
2-amino-4-[5-[5-(4-fluorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol;but-2-enedioic acid (PubChem CID 69339258) has the molecular formula C24H28FNO5S and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-amino-4-[5-[5-(4-fluorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol;but-2-enedioic acid.
| Compound Name | 2-amino-4-[5-[5-(4-fluorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol;but-2-enedioic acid |
|---|---|
| PubChem CID | 69339258 |
| Molecular Formula | C24H28FNO5S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-amino-4-[5-[5-(4-fluorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol;but-2-enedioic acid |
| SMILES | CC(N)(CO)CCc1ccc(C#CCCCc2ccc(F)cc2)s1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H24FNOS.C4H4O4/c1-20(22,15-23)14-13-19-12-11-18(24-19)6-4-2-3-5-16-7-9-17(21)10-8-16;5-3(6)1-2-4(7)8/h7-12,23H,2-3,5,13-15,22H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | SPAHMOCFECLMKA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|