C21H29NOS — CID 10132222
2-amino-2-methyl-4-[5-[(E)-6-phenylhex-1-enyl]thiophen-2-yl]butan-1-ol (PubChem CID 10132222) has the molecular formula C21H29NOS and a molecular weight of 343.54 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-[(E)-6-phenylhex-1-enyl]thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-[(E)-6-phenylhex-1-enyl]thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 10132222 |
| Molecular Formula | C21H29NOS |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-amino-2-methyl-4-[5-[(E)-6-phenylhex-1-enyl]thiophen-2-yl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(/C=C/CCCCc2ccccc2)s1 |
| InChI | InChI=1S/C21H29NOS/c1-21(22,17-23)16-15-20-14-13-19(24-20)12-8-3-2-5-9-18-10-6-4-7-11-18/h4,6-8,10-14,23H,2-3,5,9,15-17,22H2,1H3/b12-8+ |
| InChIKey | FSXAPHCTAYLAQP-XYOKQWHBSA-N |
| XLogP | 4.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|