C19H25NOS — CID 85059232
2-amino-2-methyl-4-[5-(4-phenylbut-1-enyl)thiophen-2-yl]butan-1-ol (PubChem CID 85059232) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-(4-phenylbut-1-enyl)thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-(4-phenylbut-1-enyl)thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 85059232 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-amino-2-methyl-4-[5-(4-phenylbut-1-enyl)thiophen-2-yl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(C=CCCc2ccccc2)s1 |
| InChI | InChI=1S/C19H25NOS/c1-19(20,15-21)14-13-18-12-11-17(22-18)10-6-5-9-16-7-3-2-4-8-16/h2-4,6-8,10-12,21H,5,9,13-15,20H2,1H3 |
| InChIKey | VYJKNDDYLZJKAO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |