C23H27NOS — CID 22279732
2-amino-2-methyl-4-[5-[2-(4-phenylphenyl)ethyl]thiophen-2-yl]butan-1-ol (PubChem CID 22279732) has the molecular formula C23H27NOS and a molecular weight of 365.54 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-[2-(4-phenylphenyl)ethyl]thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-[2-(4-phenylphenyl)ethyl]thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 22279732 |
| Molecular Formula | C23H27NOS |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-amino-2-methyl-4-[5-[2-(4-phenylphenyl)ethyl]thiophen-2-yl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(CCc2ccc(-c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C23H27NOS/c1-23(24,17-25)16-15-22-14-13-21(26-22)12-9-18-7-10-20(11-8-18)19-5-3-2-4-6-19/h2-8,10-11,13-14,25H,9,12,15-17,24H2,1H3 |
| InChIKey | SLVVCRLHPASFPJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |