C20H25NO2S — CID 22279917
2-amino-2-methyl-4-[5-[2-(4-propoxyphenyl)ethynyl]thiophen-2-yl]butan-1-ol (PubChem CID 22279917) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-[2-(4-propoxyphenyl)ethynyl]thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-[2-(4-propoxyphenyl)ethynyl]thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 22279917 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-amino-2-methyl-4-[5-[2-(4-propoxyphenyl)ethynyl]thiophen-2-yl]butan-1-ol |
| SMILES | CCCOc1ccc(C#Cc2ccc(CCC(C)(N)CO)s2)cc1 |
| InChI | InChI=1S/C20H25NO2S/c1-3-14-23-17-7-4-16(5-8-17)6-9-18-10-11-19(24-18)12-13-20(2,21)15-22/h4-5,7-8,10-11,22H,3,12-15,21H2,1-2H3 |
| InChIKey | YOKATJKNRSPDJL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|