C19H22ClNO2S — CID 22279844
2-amino-4-[5-[4-(4-chlorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol (PubChem CID 22279844) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is 2-amino-4-[5-[4-(4-chlorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol.
| Compound Name | 2-amino-4-[5-[4-(4-chlorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 22279844 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-amino-4-[5-[4-(4-chlorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(C#CCCOc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C19H22ClNO2S/c1-19(21,14-22)12-11-18-10-9-17(24-18)4-2-3-13-23-16-7-5-15(20)6-8-16/h5-10,22H,3,11-14,21H2,1H3 |
| InChIKey | VLUXXFMXQPFFJI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|