C20H22ClNO7 — CID 66673114
(2R)-2-amino-4-[5-[3-(4-chlorophenoxy)prop-1-ynyl]furan-2-yl]-2-methylbutan-1-ol;oxalic acid (PubChem CID 66673114) has the molecular formula C20H22ClNO7 and a molecular weight of 423.85 g/mol. Its IUPAC name is (2R)-2-amino-4-[5-[3-(4-chlorophenoxy)prop-1-ynyl]furan-2-yl]-2-methylbutan-1-ol;oxalic acid.
| Compound Name | (2R)-2-amino-4-[5-[3-(4-chlorophenoxy)prop-1-ynyl]furan-2-yl]-2-methylbutan-1-ol;oxalic acid |
|---|---|
| PubChem CID | 66673114 |
| Molecular Formula | C20H22ClNO7 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (2R)-2-amino-4-[5-[3-(4-chlorophenoxy)prop-1-ynyl]furan-2-yl]-2-methylbutan-1-ol;oxalic acid |
| SMILES | C[C@](N)(CO)CCc1ccc(C#CCOc2ccc(Cl)cc2)o1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H20ClNO3.C2H2O4/c1-18(20,13-21)11-10-17-9-8-16(23-17)3-2-12-22-15-6-4-14(19)5-7-15;3-1(4)2(5)6/h4-9,21H,10-13,20H2,1H3;(H,3,4)(H,5,6)/t18-;/m1./s1 |
| InChIKey | AMMLLNHOAPQOHX-GMUIIQOCSA-N |
| XLogP | 2.16 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|